C13H7N3O5S2 — CID 12027378
2-(3,5-dinitrophenyl)sulfinyl-1,3-benzothiazole (PubChem CID 12027378) has the molecular formula C13H7N3O5S2 and a molecular weight of 349.35 g/mol. Its IUPAC name is 2-(3,5-dinitrophenyl)sulfinyl-1,3-benzothiazole.
| Compound Name | 2-(3,5-dinitrophenyl)sulfinyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 12027378 |
| Molecular Formula | C13H7N3O5S2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 2-(3,5-dinitrophenyl)sulfinyl-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])cc(S(=O)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C13H7N3O5S2/c17-15(18)8-5-9(16(19)20)7-10(6-8)23(21)13-14-11-3-1-2-4-12(11)22-13/h1-7H |
| InChIKey | NELNPHOTRHMODY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 116.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|