C13H8BrN3O2S — CID 19930351
2-(1,3-benzothiazol-2-yl)-6-bromo-4-nitroaniline (PubChem CID 19930351) has the molecular formula C13H8BrN3O2S and a molecular weight of 350.20 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-6-bromo-4-nitroaniline.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-6-bromo-4-nitroaniline |
|---|---|
| PubChem CID | 19930351 |
| Molecular Formula | C13H8BrN3O2S |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-6-bromo-4-nitroaniline |
| SMILES | Nc1c(Br)cc([N+](=O)[O-])cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H8BrN3O2S/c14-9-6-7(17(18)19)5-8(12(9)15)13-16-10-3-1-2-4-11(10)20-13/h1-6H,15H2 |
| InChIKey | FTMYDAGMTWLKMK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|