C16H14Cl2N2O2S — CID 90998674
2-[(2,6-dichloro-4-nitrophenyl)methyl]-1,3-benzothiazole;ethane (PubChem CID 90998674) has the molecular formula C16H14Cl2N2O2S and a molecular weight of 369.27 g/mol. Its IUPAC name is 2-[(2,6-dichloro-4-nitrophenyl)methyl]-1,3-benzothiazole;ethane.
| Compound Name | 2-[(2,6-dichloro-4-nitrophenyl)methyl]-1,3-benzothiazole;ethane |
|---|---|
| PubChem CID | 90998674 |
| Molecular Formula | C16H14Cl2N2O2S |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 2-[(2,6-dichloro-4-nitrophenyl)methyl]-1,3-benzothiazole;ethane |
| SMILES | CC.O=[N+]([O-])c1cc(Cl)c(Cc2nc3ccccc3s2)c(Cl)c1 |
| InChI | InChI=1S/C14H8Cl2N2O2S.C2H6/c15-10-5-8(18(19)20)6-11(16)9(10)7-14-17-12-3-1-2-4-13(12)21-14;1-2/h1-6H,7H2;1-2H3 |
| InChIKey | ZTBYUFOJNWUZEO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|