C18H15N3O5S — CID 9372535
methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)carbamoyl]-5-nitrobenzoate (PubChem CID 9372535) has the molecular formula C18H15N3O5S and a molecular weight of 385.40 g/mol. Its IUPAC name is methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)carbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 9372535 |
| Molecular Formula | C18H15N3O5S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)carbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)N(C)Cc2nc3ccccc3s2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15N3O5S/c1-20(10-16-19-14-5-3-4-6-15(14)27-16)17(22)11-7-12(18(23)26-2)9-13(8-11)21(24)25/h3-9H,10H2,1-2H3 |
| InChIKey | MXTDOPOAUQMVBZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|