C17H13N5O3S — CID 35412407
N-(1,3-benzothiazol-2-ylmethyl)-N-methyl-5-nitro-1H-indazole-3-carboxamide (PubChem CID 35412407) has the molecular formula C17H13N5O3S and a molecular weight of 367.39 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-N-methyl-5-nitro-1H-indazole-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-N-methyl-5-nitro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 35412407 |
| Molecular Formula | C17H13N5O3S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-N-methyl-5-nitro-1H-indazole-3-carboxamide |
| SMILES | CN(Cc1nc2ccccc2s1)C(=O)c1n[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H13N5O3S/c1-21(9-15-18-13-4-2-3-5-14(13)26-15)17(23)16-11-8-10(22(24)25)6-7-12(11)19-20-16/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | VBHDXYRZRKHWBT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|