C14H11BrN4O3S — CID 134060234
N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitro-1H-indazole-3-carboxamide (PubChem CID 134060234) has the molecular formula C14H11BrN4O3S and a molecular weight of 395.24 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitro-1H-indazole-3-carboxamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 134060234 |
| Molecular Formula | C14H11BrN4O3S |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitro-1H-indazole-3-carboxamide |
| SMILES | CN(Cc1ccc(Br)s1)C(=O)c1n[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C14H11BrN4O3S/c1-18(7-9-3-5-12(15)23-9)14(20)13-10-6-8(19(21)22)2-4-11(10)16-17-13/h2-6H,7H2,1H3,(H,16,17) |
| InChIKey | JOQGPCRLAWXLRE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|