C10H11F3N2O2S2 — CID 155226655
(Z)-N-methoxy-2-[2-[(S)-3,4,4-trifluorobut-3-enylsulfinyl]-1,3-thiazol-5-yl]ethanimine (PubChem CID 155226655) has the molecular formula C10H11F3N2O2S2 and a molecular weight of 312.34 g/mol. Its IUPAC name is (Z)-N-methoxy-2-[2-[(S)-3,4,4-trifluorobut-3-enylsulfinyl]-1,3-thiazol-5-yl]ethanimine.
| Compound Name | (Z)-N-methoxy-2-[2-[(S)-3,4,4-trifluorobut-3-enylsulfinyl]-1,3-thiazol-5-yl]ethanimine |
|---|---|
| PubChem CID | 155226655 |
| Molecular Formula | C10H11F3N2O2S2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | (Z)-N-methoxy-2-[2-[(S)-3,4,4-trifluorobut-3-enylsulfinyl]-1,3-thiazol-5-yl]ethanimine |
| SMILES | CO/N=C\Cc1cnc([S@@](=O)CCC(F)=C(F)F)s1 |
| InChI | InChI=1S/C10H11F3N2O2S2/c1-17-15-4-2-7-6-14-10(18-7)19(16)5-3-8(11)9(12)13/h4,6H,2-3,5H2,1H3/b15-4-/t19-/m0/s1 |
| InChIKey | GXJYICAGVKEJAJ-BXPWKZNBSA-N |
| XLogP | 2.89 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|