C10H6F3N3O3S — CID 68663859
[6-(hydrazinecarbonyl)-1,3-benzothiazol-2-yl] 2,2,2-trifluoroacetate (PubChem CID 68663859) has the molecular formula C10H6F3N3O3S and a molecular weight of 305.24 g/mol. Its IUPAC name is [6-(hydrazinecarbonyl)-1,3-benzothiazol-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [6-(hydrazinecarbonyl)-1,3-benzothiazol-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68663859 |
| Molecular Formula | C10H6F3N3O3S |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | [6-(hydrazinecarbonyl)-1,3-benzothiazol-2-yl] 2,2,2-trifluoroacetate |
| SMILES | NNC(=O)c1ccc2nc(OC(=O)C(F)(F)F)sc2c1 |
| InChI | InChI=1S/C10H6F3N3O3S/c11-10(12,13)8(18)19-9-15-5-2-1-4(7(17)16-14)3-6(5)20-9/h1-3H,14H2,(H,16,17) |
| InChIKey | SIPPAHQCMGRQNC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|