C19H14N4O3S — CID 70148592
[6-[(6-methylquinolin-5-yl)carbamoyl]-1,3-benzothiazol-2-yl] carbamate (PubChem CID 70148592) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is [6-[(6-methylquinolin-5-yl)carbamoyl]-1,3-benzothiazol-2-yl] carbamate.
| Compound Name | [6-[(6-methylquinolin-5-yl)carbamoyl]-1,3-benzothiazol-2-yl] carbamate |
|---|---|
| PubChem CID | 70148592 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | [6-[(6-methylquinolin-5-yl)carbamoyl]-1,3-benzothiazol-2-yl] carbamate |
| SMILES | Cc1ccc2ncccc2c1NC(=O)c1ccc2nc(OC(N)=O)sc2c1 |
| InChI | InChI=1S/C19H14N4O3S/c1-10-4-6-13-12(3-2-8-21-13)16(10)23-17(24)11-5-7-14-15(9-11)27-19(22-14)26-18(20)25/h2-9H,1H3,(H2,20,25)(H,23,24) |
| InChIKey | LMWFZNXQTKWSHI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |