C21H22ClN3O2S — CID 22634194
N-(2-chloro-6-methylphenyl)-2-(hexanoylamino)-1,3-benzothiazole-6-carboxamide (PubChem CID 22634194) has the molecular formula C21H22ClN3O2S and a molecular weight of 415.95 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-(hexanoylamino)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-(hexanoylamino)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 22634194 |
| Molecular Formula | C21H22ClN3O2S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-(hexanoylamino)-1,3-benzothiazole-6-carboxamide |
| SMILES | CCCCCC(=O)Nc1nc2ccc(C(=O)Nc3c(C)cccc3Cl)cc2s1 |
| InChI | InChI=1S/C21H22ClN3O2S/c1-3-4-5-9-18(26)24-21-23-16-11-10-14(12-17(16)28-21)20(27)25-19-13(2)7-6-8-15(19)22/h6-8,10-12H,3-5,9H2,1-2H3,(H,25,27)(H,23,24,26) |
| InChIKey | SBJVTGKOJYSGRD-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|