C22H24ClN3O2SSi — CID 22634155
N-(2-chloro-6-methylphenyl)-2-[(2-trimethylsilylcyclopropanecarbonyl)amino]-1,3-benzothiazole-6-carboxamide (PubChem CID 22634155) has the molecular formula C22H24ClN3O2SSi and a molecular weight of 458.06 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[(2-trimethylsilylcyclopropanecarbonyl)amino]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[(2-trimethylsilylcyclopropanecarbonyl)amino]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 22634155 |
| Molecular Formula | C22H24ClN3O2SSi |
| Molecular Weight | 458.06 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[(2-trimethylsilylcyclopropanecarbonyl)amino]-1,3-benzothiazole-6-carboxamide |
| SMILES | Cc1cccc(Cl)c1NC(=O)c1ccc2nc(NC(=O)C3CC3[Si](C)(C)C)sc2c1 |
| InChI | InChI=1S/C22H24ClN3O2SSi/c1-12-6-5-7-15(23)19(12)25-20(27)13-8-9-16-17(10-13)29-22(24-16)26-21(28)14-11-18(14)30(2,3)4/h5-10,14,18H,11H2,1-4H3,(H,25,27)(H,24,26,28) |
| InChIKey | NEBKGBDWGVHRGS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.06 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|