C11H12N2O2S — CID 68765772
N-(methoxymethyl)-2-methyl-1,3-benzothiazole-6-carboxamide (PubChem CID 68765772) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is N-(methoxymethyl)-2-methyl-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(methoxymethyl)-2-methyl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 68765772 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | N-(methoxymethyl)-2-methyl-1,3-benzothiazole-6-carboxamide |
| SMILES | COCNC(=O)c1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C11H12N2O2S/c1-7-13-9-4-3-8(5-10(9)16-7)11(14)12-6-15-2/h3-5H,6H2,1-2H3,(H,12,14) |
| InChIKey | DKFDKPYGYNHAJR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|