C19H19FN2O3S — CID 68987630
N-[2-fluoro-3-(3-methoxypropoxy)phenyl]-2-methyl-1,3-benzothiazole-6-carboxamide (PubChem CID 68987630) has the molecular formula C19H19FN2O3S and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[2-fluoro-3-(3-methoxypropoxy)phenyl]-2-methyl-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[2-fluoro-3-(3-methoxypropoxy)phenyl]-2-methyl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 68987630 |
| Molecular Formula | C19H19FN2O3S |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-[2-fluoro-3-(3-methoxypropoxy)phenyl]-2-methyl-1,3-benzothiazole-6-carboxamide |
| SMILES | COCCCOc1cccc(NC(=O)c2ccc3nc(C)sc3c2)c1F |
| InChI | InChI=1S/C19H19FN2O3S/c1-12-21-14-8-7-13(11-17(14)26-12)19(23)22-15-5-3-6-16(18(15)20)25-10-4-9-24-2/h3,5-8,11H,4,9-10H2,1-2H3,(H,22,23) |
| InChIKey | UPMUVNAHBMSCEY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|