C22H21FN2O2S — CID 68986624
N-(2-fluoro-3-hept-5-ynoxyphenyl)-2-methyl-1,3-benzothiazole-6-carboxamide (PubChem CID 68986624) has the molecular formula C22H21FN2O2S and a molecular weight of 396.49 g/mol. Its IUPAC name is N-(2-fluoro-3-hept-5-ynoxyphenyl)-2-methyl-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(2-fluoro-3-hept-5-ynoxyphenyl)-2-methyl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 68986624 |
| Molecular Formula | C22H21FN2O2S |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-(2-fluoro-3-hept-5-ynoxyphenyl)-2-methyl-1,3-benzothiazole-6-carboxamide |
| SMILES | CC#CCCCCOc1cccc(NC(=O)c2ccc3nc(C)sc3c2)c1F |
| InChI | InChI=1S/C22H21FN2O2S/c1-3-4-5-6-7-13-27-19-10-8-9-18(21(19)23)25-22(26)16-11-12-17-20(14-16)28-15(2)24-17/h8-12,14H,5-7,13H2,1-2H3,(H,25,26) |
| InChIKey | SEQLHQKROMBHFA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|