C17H15F2N3O2 — CID 150972391
2-amino-N-(3-but-2-ynoxy-2-fluorophenyl)-6-fluoro-5-methylpyridine-3-carboxamide (PubChem CID 150972391) has the molecular formula C17H15F2N3O2 and a molecular weight of 331.32 g/mol. Its IUPAC name is 2-amino-N-(3-but-2-ynoxy-2-fluorophenyl)-6-fluoro-5-methylpyridine-3-carboxamide.
| Compound Name | 2-amino-N-(3-but-2-ynoxy-2-fluorophenyl)-6-fluoro-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 150972391 |
| Molecular Formula | C17H15F2N3O2 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-amino-N-(3-but-2-ynoxy-2-fluorophenyl)-6-fluoro-5-methylpyridine-3-carboxamide |
| SMILES | CC#CCOc1cccc(NC(=O)c2cc(C)c(F)nc2N)c1F |
| InChI | InChI=1S/C17H15F2N3O2/c1-3-4-8-24-13-7-5-6-12(14(13)18)21-17(23)11-9-10(2)15(19)22-16(11)20/h5-7,9H,8H2,1-2H3,(H2,20,22)(H,21,23) |
| InChIKey | LOJOUSWIEWOTJN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|