C21H26FN3O3 — CID 150214982
2-amino-N-(2-fluoro-3-hex-5-enoxyphenyl)-6-(methoxymethyl)-5-methylpyridine-3-carboxamide (PubChem CID 150214982) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-amino-N-(2-fluoro-3-hex-5-enoxyphenyl)-6-(methoxymethyl)-5-methylpyridine-3-carboxamide.
| Compound Name | 2-amino-N-(2-fluoro-3-hex-5-enoxyphenyl)-6-(methoxymethyl)-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 150214982 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-amino-N-(2-fluoro-3-hex-5-enoxyphenyl)-6-(methoxymethyl)-5-methylpyridine-3-carboxamide |
| SMILES | C=CCCCCOc1cccc(NC(=O)c2cc(C)c(COC)nc2N)c1F |
| InChI | InChI=1S/C21H26FN3O3/c1-4-5-6-7-11-28-18-10-8-9-16(19(18)22)25-21(26)15-12-14(2)17(13-27-3)24-20(15)23/h4,8-10,12H,1,5-7,11,13H2,2-3H3,(H2,23,24)(H,25,26) |
| InChIKey | FSHBMBIEONVYLC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|