C20H24FN3O2 — CID 66843382
2-amino-N-[(2-fluoro-3-hept-6-enoxyphenyl)methyl]pyridine-3-carboxamide (PubChem CID 66843382) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-amino-N-[(2-fluoro-3-hept-6-enoxyphenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 2-amino-N-[(2-fluoro-3-hept-6-enoxyphenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66843382 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2-amino-N-[(2-fluoro-3-hept-6-enoxyphenyl)methyl]pyridine-3-carboxamide |
| SMILES | C=CCCCCCOc1cccc(CNC(=O)c2cccnc2N)c1F |
| InChI | InChI=1S/C20H24FN3O2/c1-2-3-4-5-6-13-26-17-11-7-9-15(18(17)21)14-24-20(25)16-10-8-12-23-19(16)22/h2,7-12H,1,3-6,13-14H2,(H2,22,23)(H,24,25) |
| InChIKey | BUEGJZONLJSRQB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|