C21H24FN3O3 — CID 87176359
2-amino-N-[(2-fluoro-3-hex-5-ynoxyphenyl)methyl]-6-(methoxymethyl)pyridine-3-carboxamide (PubChem CID 87176359) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-amino-N-[(2-fluoro-3-hex-5-ynoxyphenyl)methyl]-6-(methoxymethyl)pyridine-3-carboxamide.
| Compound Name | 2-amino-N-[(2-fluoro-3-hex-5-ynoxyphenyl)methyl]-6-(methoxymethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87176359 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 2-amino-N-[(2-fluoro-3-hex-5-ynoxyphenyl)methyl]-6-(methoxymethyl)pyridine-3-carboxamide |
| SMILES | C#CCCCCOc1cccc(CNC(=O)c2ccc(COC)nc2N)c1F |
| InChI | InChI=1S/C21H24FN3O3/c1-3-4-5-6-12-28-18-9-7-8-15(19(18)22)13-24-21(26)17-11-10-16(14-27-2)25-20(17)23/h1,7-11H,4-6,12-14H2,2H3,(H2,23,25)(H,24,26) |
| InChIKey | HZWMNOTUNPPQEB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|