C19H22FN3O3 — CID 66843035
2-amino-N-[(3-but-2-enoxy-2-fluorophenyl)methyl]-6-(methoxymethyl)pyridine-3-carboxamide (PubChem CID 66843035) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is 2-amino-N-[(3-but-2-enoxy-2-fluorophenyl)methyl]-6-(methoxymethyl)pyridine-3-carboxamide.
| Compound Name | 2-amino-N-[(3-but-2-enoxy-2-fluorophenyl)methyl]-6-(methoxymethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66843035 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-amino-N-[(3-but-2-enoxy-2-fluorophenyl)methyl]-6-(methoxymethyl)pyridine-3-carboxamide |
| SMILES | CC=CCOc1cccc(CNC(=O)c2ccc(COC)nc2N)c1F |
| InChI | InChI=1S/C19H22FN3O3/c1-3-4-10-26-16-7-5-6-13(17(16)20)11-22-19(24)15-9-8-14(12-25-2)23-18(15)21/h3-9H,10-12H2,1-2H3,(H2,21,23)(H,22,24) |
| InChIKey | CYXRUWNYPZDNTH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|