C20H18FN3O2 — CID 151247980
N-(3-but-2-enoxy-2-fluorophenyl)-3-methyl-1,5-naphthyridine-2-carboxamide (PubChem CID 151247980) has the molecular formula C20H18FN3O2 and a molecular weight of 351.38 g/mol. Its IUPAC name is N-(3-but-2-enoxy-2-fluorophenyl)-3-methyl-1,5-naphthyridine-2-carboxamide.
| Compound Name | N-(3-but-2-enoxy-2-fluorophenyl)-3-methyl-1,5-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 151247980 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-(3-but-2-enoxy-2-fluorophenyl)-3-methyl-1,5-naphthyridine-2-carboxamide |
| SMILES | CC=CCOc1cccc(NC(=O)c2nc3cccnc3cc2C)c1F |
| InChI | InChI=1S/C20H18FN3O2/c1-3-4-11-26-17-9-5-7-15(18(17)21)24-20(25)19-13(2)12-16-14(23-19)8-6-10-22-16/h3-10,12H,11H2,1-2H3,(H,24,25) |
| InChIKey | NRSCAPOOLQVIID-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|