C36H65N3O2S3 — CID 173374825
2-(1,3-benzothiazol-2-yl)-2-methylbutanebis(thioic S-acid);bis(N,N-dibutylbutan-1-amine) (PubChem CID 173374825) has the molecular formula C36H65N3O2S3 and a molecular weight of 668.14 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-2-methylbutanebis(thioic S-acid);bis(N,N-dibutylbutan-1-amine).
| Compound Name | 2-(1,3-benzothiazol-2-yl)-2-methylbutanebis(thioic S-acid);bis(N,N-dibutylbutan-1-amine) |
|---|---|
| PubChem CID | 173374825 |
| Molecular Formula | C36H65N3O2S3 |
| Molecular Weight | 668.14 g/mol |
| Exact Mass | 667.42 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-2-methylbutanebis(thioic S-acid);bis(N,N-dibutylbutan-1-amine) |
| SMILES | CC(CC(=O)S)(C(=O)S)c1nc2ccccc2s1.CCCCN(CCCC)CCCC.CCCCN(CCCC)CCCC |
| InChI | InChI=1S/C12H11NO2S3.2C12H27N/c1-12(11(15)17,6-9(14)16)10-13-7-4-2-3-5-8(7)18-10;2*1-4-7-10-13(11-8-5-2)12-9-6-3/h2-5H,6H2,1H3,(H,14,16)(H,15,17);2*4-12H2,1-3H3 |
| InChIKey | HDMOIPWOMUEYGN-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 53.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.14 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|