C15H19NS — CID 122202776
2-[(3S)-3-methylhept-1-en-3-yl]-1,3-benzothiazole (PubChem CID 122202776) has the molecular formula C15H19NS and a molecular weight of 245.39 g/mol. Its IUPAC name is 2-[(3S)-3-methylhept-1-en-3-yl]-1,3-benzothiazole.
| Compound Name | 2-[(3S)-3-methylhept-1-en-3-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 122202776 |
| Molecular Formula | C15H19NS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-[(3S)-3-methylhept-1-en-3-yl]-1,3-benzothiazole |
| SMILES | C=C[C@](C)(CCCC)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H19NS/c1-4-6-11-15(3,5-2)14-16-12-9-7-8-10-13(12)17-14/h5,7-10H,2,4,6,11H2,1,3H3/t15-/m1/s1 |
| InChIKey | PLPRWGZIOAJUAI-OAHLLOKOSA-N |
| XLogP | 4.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|