C20H21NS — CID 132838792
2-[(3R)-3-ethyl-5-phenylpent-1-en-3-yl]-1,3-benzothiazole (PubChem CID 132838792) has the molecular formula C20H21NS and a molecular weight of 307.46 g/mol. Its IUPAC name is 2-[(3R)-3-ethyl-5-phenylpent-1-en-3-yl]-1,3-benzothiazole.
| Compound Name | 2-[(3R)-3-ethyl-5-phenylpent-1-en-3-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 132838792 |
| Molecular Formula | C20H21NS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[(3R)-3-ethyl-5-phenylpent-1-en-3-yl]-1,3-benzothiazole |
| SMILES | C=C[C@@](CC)(CCc1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H21NS/c1-3-20(4-2,15-14-16-10-6-5-7-11-16)19-21-17-12-8-9-13-18(17)22-19/h3,5-13H,1,4,14-15H2,2H3/t20-/m1/s1 |
| InChIKey | PYMKUNCJJYHSTH-HXUWFJFHSA-N |
| XLogP | 5.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|