C18H16BrNOS — CID 175437301
1-(1,3-benzothiazol-2-yl)-1-(4-bromophenyl)pent-4-en-1-ol (PubChem CID 175437301) has the molecular formula C18H16BrNOS and a molecular weight of 374.30 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-1-(4-bromophenyl)pent-4-en-1-ol.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-1-(4-bromophenyl)pent-4-en-1-ol |
|---|---|
| PubChem CID | 175437301 |
| Molecular Formula | C18H16BrNOS |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-1-(4-bromophenyl)pent-4-en-1-ol |
| SMILES | C=CCCC(O)(c1ccc(Br)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H16BrNOS/c1-2-3-12-18(21,13-8-10-14(19)11-9-13)17-20-15-6-4-5-7-16(15)22-17/h2,4-11,21H,1,3,12H2 |
| InChIKey | QTIYSVWYXHPAQV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|