C15H15NS — CID 89265111
2-[(3E,5Z)-octa-1,3,5-trien-4-yl]-1,3-benzothiazole (PubChem CID 89265111) has the molecular formula C15H15NS and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-[(3E,5Z)-octa-1,3,5-trien-4-yl]-1,3-benzothiazole.
| Compound Name | 2-[(3E,5Z)-octa-1,3,5-trien-4-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 89265111 |
| Molecular Formula | C15H15NS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-[(3E,5Z)-octa-1,3,5-trien-4-yl]-1,3-benzothiazole |
| SMILES | C=C/C=C(\C=C/CC)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H15NS/c1-3-5-9-12(8-4-2)15-16-13-10-6-7-11-14(13)17-15/h4-11H,2-3H2,1H3/b9-5-,12-8+ |
| InChIKey | UGJNFKGETQIVPI-ZYEZJADKSA-N |
| XLogP | 4.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|