C18H21NS — CID 90727393
2-(7,7-dimethyl-5-methylideneocta-1,3-dien-3-yl)-1,3-benzothiazole (PubChem CID 90727393) has the molecular formula C18H21NS and a molecular weight of 283.44 g/mol. Its IUPAC name is 2-(7,7-dimethyl-5-methylideneocta-1,3-dien-3-yl)-1,3-benzothiazole.
| Compound Name | 2-(7,7-dimethyl-5-methylideneocta-1,3-dien-3-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 90727393 |
| Molecular Formula | C18H21NS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-(7,7-dimethyl-5-methylideneocta-1,3-dien-3-yl)-1,3-benzothiazole |
| SMILES | C=CC(=CC(=C)CC(C)(C)C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H21NS/c1-6-14(11-13(2)12-18(3,4)5)17-19-15-9-7-8-10-16(15)20-17/h6-11H,1-2,12H2,3-5H3 |
| InChIKey | OERGAEHXUAACKB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|