C23H28N2S — CID 143388060
(Z,2E)-N-[(3E,5E)-6-(1,3-benzothiazol-2-yl)hepta-1,3,5-trien-3-yl]-2-ethylidenehept-4-en-1-amine (PubChem CID 143388060) has the molecular formula C23H28N2S and a molecular weight of 364.56 g/mol. Its IUPAC name is (Z,2E)-N-[(3E,5E)-6-(1,3-benzothiazol-2-yl)hepta-1,3,5-trien-3-yl]-2-ethylidenehept-4-en-1-amine.
| Compound Name | (Z,2E)-N-[(3E,5E)-6-(1,3-benzothiazol-2-yl)hepta-1,3,5-trien-3-yl]-2-ethylidenehept-4-en-1-amine |
|---|---|
| PubChem CID | 143388060 |
| Molecular Formula | C23H28N2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (Z,2E)-N-[(3E,5E)-6-(1,3-benzothiazol-2-yl)hepta-1,3,5-trien-3-yl]-2-ethylidenehept-4-en-1-amine |
| SMILES | C=C/C(=C\C=C(/C)c1nc2ccccc2s1)NC/C(=C/C)C/C=C\CC |
| InChI | InChI=1S/C23H28N2S/c1-5-8-9-12-19(6-2)17-24-20(7-3)16-15-18(4)23-25-21-13-10-11-14-22(21)26-23/h6-11,13-16,24H,3,5,12,17H2,1-2,4H3/b9-8-,18-15+,19-6+,20-16+ |
| InChIKey | SEFNEEVPHZOLDK-MUVVONTKSA-N |
| XLogP | 6.66 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|