C15H22N2S2 — CID 87210910
N-(1,3-benzothiazol-2-ylsulfanyl)-N,2-dimethylhexan-2-amine (PubChem CID 87210910) has the molecular formula C15H22N2S2 and a molecular weight of 294.49 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylsulfanyl)-N,2-dimethylhexan-2-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylsulfanyl)-N,2-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 87210910 |
| Molecular Formula | C15H22N2S2 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylsulfanyl)-N,2-dimethylhexan-2-amine |
| SMILES | CCCCC(C)(C)N(C)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H22N2S2/c1-5-6-11-15(2,3)17(4)19-14-16-12-9-7-8-10-13(12)18-14/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | QUXYNEDLPUWXAI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|