C29H27N7O2 — CID 177179522
6-amino-2-ethyl-7-[(3S)-oxolan-3-yl]oxy-4-[[2-(pyridin-2-ylmethyl)indazol-5-yl]amino]quinoline-3-carbonitrile (PubChem CID 177179522) has the molecular formula C29H27N7O2 and a molecular weight of 505.58 g/mol. Its IUPAC name is 6-amino-2-ethyl-7-[(3S)-oxolan-3-yl]oxy-4-[[2-(pyridin-2-ylmethyl)indazol-5-yl]amino]quinoline-3-carbonitrile.
| Compound Name | 6-amino-2-ethyl-7-[(3S)-oxolan-3-yl]oxy-4-[[2-(pyridin-2-ylmethyl)indazol-5-yl]amino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 177179522 |
| Molecular Formula | C29H27N7O2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 6-amino-2-ethyl-7-[(3S)-oxolan-3-yl]oxy-4-[[2-(pyridin-2-ylmethyl)indazol-5-yl]amino]quinoline-3-carbonitrile |
| SMILES | CCc1nc2cc(O[C@H]3CCOC3)c(N)cc2c(Nc2ccc3nn(Cc4ccccn4)cc3c2)c1C#N |
| InChI | InChI=1S/C29H27N7O2/c1-2-25-23(14-30)29(22-12-24(31)28(13-27(22)34-25)38-21-8-10-37-17-21)33-19-6-7-26-18(11-19)15-36(35-26)16-20-5-3-4-9-32-20/h3-7,9,11-13,15,21H,2,8,10,16-17,31H2,1H3,(H,33,34)/t21-/m0/s1 |
| InChIKey | HMTKVWTZCYXTCB-NRFANRHFSA-N |
| XLogP | 4.96 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|