C31H35N5O3 — CID 130312690
(E)-N-[3-cyano-4-(3-ethenylanilino)-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-(diethylamino)-N-methylbut-2-enamide (PubChem CID 130312690) has the molecular formula C31H35N5O3 and a molecular weight of 525.65 g/mol. Its IUPAC name is (E)-N-[3-cyano-4-(3-ethenylanilino)-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-(diethylamino)-N-methylbut-2-enamide.
| Compound Name | (E)-N-[3-cyano-4-(3-ethenylanilino)-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-(diethylamino)-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 130312690 |
| Molecular Formula | C31H35N5O3 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | (E)-N-[3-cyano-4-(3-ethenylanilino)-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-(diethylamino)-N-methylbut-2-enamide |
| SMILES | C=Cc1cccc(Nc2c(C#N)cnc3cc(O[C@H]4CCOC4)c(N(C)C(=O)/C=C/CN(CC)CC)cc23)c1 |
| InChI | InChI=1S/C31H35N5O3/c1-5-22-10-8-11-24(16-22)34-31-23(19-32)20-33-27-18-29(39-25-13-15-38-21-25)28(17-26(27)31)35(4)30(37)12-9-14-36(6-2)7-3/h5,8-12,16-18,20,25H,1,6-7,13-15,21H2,2-4H3,(H,33,34)/b12-9+/t25-/m0/s1 |
| InChIKey | ZDXWNVBORJUSKY-OPATVPMHSA-N |
| XLogP | 5.52 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|