C29H28N6O3 — CID 174673822
2-[3-cyano-4-(1H-indol-5-ylamino)-7-(oxolan-3-yloxy)quinolin-6-yl]-2-piperidin-4-ylideneacetamide (PubChem CID 174673822) has the molecular formula C29H28N6O3 and a molecular weight of 508.58 g/mol. Its IUPAC name is 2-[3-cyano-4-(1H-indol-5-ylamino)-7-(oxolan-3-yloxy)quinolin-6-yl]-2-piperidin-4-ylideneacetamide.
| Compound Name | 2-[3-cyano-4-(1H-indol-5-ylamino)-7-(oxolan-3-yloxy)quinolin-6-yl]-2-piperidin-4-ylideneacetamide |
|---|---|
| PubChem CID | 174673822 |
| Molecular Formula | C29H28N6O3 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 2-[3-cyano-4-(1H-indol-5-ylamino)-7-(oxolan-3-yloxy)quinolin-6-yl]-2-piperidin-4-ylideneacetamide |
| SMILES | N#Cc1cnc2cc(OC3CCOC3)c(C(C(N)=O)=C3CCNCC3)cc2c1Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C29H28N6O3/c30-14-19-15-34-25-13-26(38-21-6-10-37-16-21)23(27(29(31)36)17-3-7-32-8-4-17)12-22(25)28(19)35-20-1-2-24-18(11-20)5-9-33-24/h1-2,5,9,11-13,15,21,32-33H,3-4,6-8,10,16H2,(H2,31,36)(H,34,35) |
| InChIKey | KFJRKJXXMLXPCM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|