C33H32N6O3 — CID 174673798
2-[3-cyano-7-(oxolan-3-yloxy)-4-(6-pyrrol-1-yl-2,3-dihydroindol-1-yl)quinolin-6-yl]-2-piperidin-4-ylideneacetamide (PubChem CID 174673798) has the molecular formula C33H32N6O3 and a molecular weight of 560.66 g/mol. Its IUPAC name is 2-[3-cyano-7-(oxolan-3-yloxy)-4-(6-pyrrol-1-yl-2,3-dihydroindol-1-yl)quinolin-6-yl]-2-piperidin-4-ylideneacetamide.
| Compound Name | 2-[3-cyano-7-(oxolan-3-yloxy)-4-(6-pyrrol-1-yl-2,3-dihydroindol-1-yl)quinolin-6-yl]-2-piperidin-4-ylideneacetamide |
|---|---|
| PubChem CID | 174673798 |
| Molecular Formula | C33H32N6O3 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | 2-[3-cyano-7-(oxolan-3-yloxy)-4-(6-pyrrol-1-yl-2,3-dihydroindol-1-yl)quinolin-6-yl]-2-piperidin-4-ylideneacetamide |
| SMILES | N#Cc1cnc2cc(OC3CCOC3)c(C(C(N)=O)=C3CCNCC3)cc2c1N1CCc2ccc(-n3cccc3)cc21 |
| InChI | InChI=1S/C33H32N6O3/c34-18-23-19-37-28-17-30(42-25-8-14-41-20-25)27(31(33(35)40)22-5-9-36-10-6-22)16-26(28)32(23)39-13-7-21-3-4-24(15-29(21)39)38-11-1-2-12-38/h1-4,11-12,15-17,19,25,36H,5-10,13-14,20H2,(H2,35,40) |
| InChIKey | VCLKQHVFPPXYFI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 118.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|