C22H17FN4O4 — CID 89496197
4-(6-fluoro-2,3-dihydroindol-1-yl)-6-nitro-7-(oxolan-3-yloxy)quinoline-3-carbonitrile (PubChem CID 89496197) has the molecular formula C22H17FN4O4 and a molecular weight of 420.40 g/mol. Its IUPAC name is 4-(6-fluoro-2,3-dihydroindol-1-yl)-6-nitro-7-(oxolan-3-yloxy)quinoline-3-carbonitrile.
| Compound Name | 4-(6-fluoro-2,3-dihydroindol-1-yl)-6-nitro-7-(oxolan-3-yloxy)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 89496197 |
| Molecular Formula | C22H17FN4O4 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 4-(6-fluoro-2,3-dihydroindol-1-yl)-6-nitro-7-(oxolan-3-yloxy)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2cc(OC3CCOC3)c([N+](=O)[O-])cc2c1N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C22H17FN4O4/c23-15-2-1-13-3-5-26(19(13)7-15)22-14(10-24)11-25-18-9-21(31-16-4-6-30-12-16)20(27(28)29)8-17(18)22/h1-2,7-9,11,16H,3-6,12H2 |
| InChIKey | OWJHLKXIROGISE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 101.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|