C26H23N3O4 — CID 71211211
6-methoxy-7-(methoxymethyl)-4-[4-(2-methoxyphenoxy)anilino]quinoline-3-carbonitrile (PubChem CID 71211211) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 6-methoxy-7-(methoxymethyl)-4-[4-(2-methoxyphenoxy)anilino]quinoline-3-carbonitrile.
| Compound Name | 6-methoxy-7-(methoxymethyl)-4-[4-(2-methoxyphenoxy)anilino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 71211211 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 6-methoxy-7-(methoxymethyl)-4-[4-(2-methoxyphenoxy)anilino]quinoline-3-carbonitrile |
| SMILES | COCc1cc2ncc(C#N)c(Nc3ccc(Oc4ccccc4OC)cc3)c2cc1OC |
| InChI | InChI=1S/C26H23N3O4/c1-30-16-17-12-22-21(13-25(17)32-3)26(18(14-27)15-28-22)29-19-8-10-20(11-9-19)33-24-7-5-4-6-23(24)31-2/h4-13,15H,16H2,1-3H3,(H,28,29) |
| InChIKey | NKKHZDNIEWYDTR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |