C46H61N5O7 — CID 169001300
6-methoxy-7-[3-[4-[6-[2-[2-(6-oxohexoxy)ethoxy]ethoxy]hexyl]piperazin-1-yl]propoxy]-4-(4-phenoxyanilino)quinoline-3-carbonitrile (PubChem CID 169001300) has the molecular formula C46H61N5O7 and a molecular weight of 796.02 g/mol. Its IUPAC name is 6-methoxy-7-[3-[4-[6-[2-[2-(6-oxohexoxy)ethoxy]ethoxy]hexyl]piperazin-1-yl]propoxy]-4-(4-phenoxyanilino)quinoline-3-carbonitrile.
| Compound Name | 6-methoxy-7-[3-[4-[6-[2-[2-(6-oxohexoxy)ethoxy]ethoxy]hexyl]piperazin-1-yl]propoxy]-4-(4-phenoxyanilino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 169001300 |
| Molecular Formula | C46H61N5O7 |
| Molecular Weight | 796.02 g/mol |
| Exact Mass | 795.46 |
| IUPAC Name | 6-methoxy-7-[3-[4-[6-[2-[2-(6-oxohexoxy)ethoxy]ethoxy]hexyl]piperazin-1-yl]propoxy]-4-(4-phenoxyanilino)quinoline-3-carbonitrile |
| SMILES | COc1cc2c(Nc3ccc(Oc4ccccc4)cc3)c(C#N)cnc2cc1OCCCN1CCN(CCCCCCOCCOCCOCCCCCC=O)CC1 |
| InChI | InChI=1S/C46H61N5O7/c1-53-44-34-42-43(48-37-38(36-47)46(42)49-39-16-18-41(19-17-39)58-40-14-7-6-8-15-40)35-45(44)57-29-13-21-51-24-22-50(23-25-51)20-9-2-4-11-27-54-30-32-56-33-31-55-28-12-5-3-10-26-52/h6-8,14-19,26,34-35,37H,2-5,9-13,20-25,27-33H2,1H3,(H,48,49) |
| InChIKey | PAKDDECIFOASMW-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.02 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|