C25H29N3O4 — CID 123735864
N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-5-propan-2-ylquinazolin-4-amine (PubChem CID 123735864) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-5-propan-2-ylquinazolin-4-amine.
| Compound Name | N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-5-propan-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 123735864 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-5-propan-2-ylquinazolin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)c(C(C)C)c23)c1 |
| InChI | InChI=1S/C25H29N3O4/c1-6-18-8-7-9-19(14-18)28-25-23-20(26-16-27-25)15-21(31-12-10-29-4)24(22(23)17(2)3)32-13-11-30-5/h1,7-9,14-17H,10-13H2,2-5H3,(H,26,27,28) |
| InChIKey | GXJWHZWKYQLBGB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|