C22H26N2O — CID 142988885
N-(2-aminophenyl)-4-methylbenzamide;(3Z,5Z)-3-methylhepta-1,3,5-triene (PubChem CID 142988885) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-methylbenzamide;(3Z,5Z)-3-methylhepta-1,3,5-triene.
| Compound Name | N-(2-aminophenyl)-4-methylbenzamide;(3Z,5Z)-3-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142988885 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-(2-aminophenyl)-4-methylbenzamide;(3Z,5Z)-3-methylhepta-1,3,5-triene |
| SMILES | C=C/C(C)=C\C=C/C.Cc1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C14H14N2O.C8H12/c1-10-6-8-11(9-7-10)14(17)16-13-5-3-2-4-12(13)15;1-4-6-7-8(3)5-2/h2-9H,15H2,1H3,(H,16,17);4-7H,2H2,1,3H3/b;6-4-,8-7- |
| InChIKey | DSUUKCUYMXGVGD-VJYDHVIHSA-N |
| XLogP | 5.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|