About acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane
acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane (PubChem CID 143456973) has the molecular formula C16H22N2O
and a molecular weight of 258.36 g/mol. Its IUPAC name is acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane.
Molecular Properties
| Compound Name | acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane |
| PubChem CID | 143456973 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane |
| SMILES | C#C.C=C/C(=C\C)C(=O)Nc1ccccc1N.CC |
| InChI | InChI=1S/C12H14N2O.C2H6.C2H2/c1-3-9(4-2)12(15)14-11-8-6-5-7-10(11)13;2*1-2/h3-8H,1,13H2,2H3,(H,14,15);1-2H3;1-2H/b9-4+;; |
| InChIKey | XGGDWUKWLUUBJT-HPJBNNNXSA-N |
| XLogP | 3.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane?
The IUPAC name of acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane (CID 143456973) is acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane.
What is the SMILES notation for acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane?
The canonical SMILES for acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane is C#C.C=C/C(=C\C)C(=O)Nc1ccccc1N.CC.
What is the InChIKey of acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane?
The InChIKey is XGGDWUKWLUUBJT-HPJBNNNXSA-N. The full InChI is InChI=1S/C12H14N2O.C2H6.C2H2/c1-3-9(4-2)12(15)14-11-8-6-5-7-10(11)13;2*1-2/h3-8H,1,13H2,2H3,(H,14,15);1-2H3;1-2H/b9-4+;;.
What are the key properties of acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane?
acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane has a molecular weight of 258.36 g/mol, XLogP of 3.62, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(E)-N-(2-aminophenyl)-2-ethenylbut-2-enamide;ethane is sourced from PubChem (CID 143456973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).