C19H32N2O — CID 144503553
(2E)-N-(2-aminophenyl)-2-ethyl-5-methylhexa-2,4-dienamide;ethane (PubChem CID 144503553) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is (2E)-N-(2-aminophenyl)-2-ethyl-5-methylhexa-2,4-dienamide;ethane.
| Compound Name | (2E)-N-(2-aminophenyl)-2-ethyl-5-methylhexa-2,4-dienamide;ethane |
|---|---|
| PubChem CID | 144503553 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | (2E)-N-(2-aminophenyl)-2-ethyl-5-methylhexa-2,4-dienamide;ethane |
| SMILES | CC.CC.CC/C(=C\C=C(C)C)C(=O)Nc1ccccc1N |
| InChI | InChI=1S/C15H20N2O.2C2H6/c1-4-12(10-9-11(2)3)15(18)17-14-8-6-5-7-13(14)16;2*1-2/h5-10H,4,16H2,1-3H3,(H,17,18);2*1-2H3/b12-10+;; |
| InChIKey | XHKNGFQPBPXOPP-PFNYCKIMSA-N |
| XLogP | 5.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|