C10H10BrN3S — CID 104540435
3-N-[(5-bromothiophen-2-yl)methyl]pyridine-2,3-diamine (PubChem CID 104540435) has the molecular formula C10H10BrN3S and a molecular weight of 284.18 g/mol. Its IUPAC name is 3-N-[(5-bromothiophen-2-yl)methyl]pyridine-2,3-diamine.
| Compound Name | 3-N-[(5-bromothiophen-2-yl)methyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 104540435 |
| Molecular Formula | C10H10BrN3S |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 3-N-[(5-bromothiophen-2-yl)methyl]pyridine-2,3-diamine |
| SMILES | Nc1ncccc1NCc1ccc(Br)s1 |
| InChI | InChI=1S/C10H10BrN3S/c11-9-4-3-7(15-9)6-14-8-2-1-5-13-10(8)12/h1-5,14H,6H2,(H2,12,13) |
| InChIKey | GAJCROUQNBRTDR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |