C18H16BrN3OS — CID 58448850
2-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]-1-(5-bromothiophen-2-yl)ethanone (PubChem CID 58448850) has the molecular formula C18H16BrN3OS and a molecular weight of 402.32 g/mol. Its IUPAC name is 2-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]-1-(5-bromothiophen-2-yl)ethanone.
| Compound Name | 2-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]-1-(5-bromothiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 58448850 |
| Molecular Formula | C18H16BrN3OS |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 2-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]-1-(5-bromothiophen-2-yl)ethanone |
| SMILES | Nc1ncccc1NCc1cccc(CC(=O)c2ccc(Br)s2)c1 |
| InChI | InChI=1S/C18H16BrN3OS/c19-17-7-6-16(24-17)15(23)10-12-3-1-4-13(9-12)11-22-14-5-2-8-21-18(14)20/h1-9,22H,10-11H2,(H2,20,21) |
| InChIKey | IQVYNNNXNXNOBB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |