C21H19N5O2 — CID 58448651
2-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone (PubChem CID 58448651) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 2-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone.
| Compound Name | 2-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 58448651 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone |
| SMILES | C#CCOc1cnc(C(=O)Cc2cccc(CNc3cccnc3N)c2)cn1 |
| InChI | InChI=1S/C21H19N5O2/c1-2-9-28-20-14-25-18(13-26-20)19(27)11-15-5-3-6-16(10-15)12-24-17-7-4-8-23-21(17)22/h1,3-8,10,13-14,24H,9,11-12H2,(H2,22,23) |
| InChIKey | PBGLRGMOCFGRSO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|