C17H15BrN4OS — CID 70234206
N-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]-5-bromothiophene-2-carboxamide (PubChem CID 70234206) has the molecular formula C17H15BrN4OS and a molecular weight of 403.31 g/mol. Its IUPAC name is N-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]-5-bromothiophene-2-carboxamide.
| Compound Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]-5-bromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 70234206 |
| Molecular Formula | C17H15BrN4OS |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]-5-bromothiophene-2-carboxamide |
| SMILES | Nc1ncccc1NCc1cccc(NC(=O)c2ccc(Br)s2)c1 |
| InChI | InChI=1S/C17H15BrN4OS/c18-15-7-6-14(24-15)17(23)22-12-4-1-3-11(9-12)10-21-13-5-2-8-20-16(13)19/h1-9,21H,10H2,(H2,19,20)(H,22,23) |
| InChIKey | ISXDZMSRXIPFOO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |