C43H46N8O2 — CID 159199604
N-[3-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]phenyl]butanamide;N-[3-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]phenyl]propanamide (PubChem CID 159199604) has the molecular formula C43H46N8O2 and a molecular weight of 706.89 g/mol. Its IUPAC name is N-[3-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]phenyl]butanamide;N-[3-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]phenyl]propanamide.
| Compound Name | N-[3-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]phenyl]butanamide;N-[3-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]phenyl]propanamide |
|---|---|
| PubChem CID | 159199604 |
| Molecular Formula | C43H46N8O2 |
| Molecular Weight | 706.89 g/mol |
| Exact Mass | 706.37 |
| IUPAC Name | N-[3-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]phenyl]butanamide;N-[3-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cccc(-c2cccc(CNc3cccnc3N)c2)c1.CCCC(=O)Nc1cccc(-c2cccc(CNc3cccnc3N)c2)c1 |
| InChI | InChI=1S/C22H24N4O.C21H22N4O/c1-2-6-21(27)26-19-10-4-9-18(14-19)17-8-3-7-16(13-17)15-25-20-11-5-12-24-22(20)23;1-2-20(26)25-18-9-4-8-17(13-18)16-7-3-6-15(12-16)14-24-19-10-5-11-23-21(19)22/h3-5,7-14,25H,2,6,15H2,1H3,(H2,23,24)(H,26,27);3-13,24H,2,14H2,1H3,(H2,22,23)(H,25,26) |
| InChIKey | KPCRUHVPBOINMA-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 160.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.89 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |