C13H13BrN2O2S — CID 54900601
ethyl 2-[(5-bromothiophen-2-yl)methylamino]pyridine-3-carboxylate (PubChem CID 54900601) has the molecular formula C13H13BrN2O2S and a molecular weight of 341.23 g/mol. Its IUPAC name is ethyl 2-[(5-bromothiophen-2-yl)methylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[(5-bromothiophen-2-yl)methylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 54900601 |
| Molecular Formula | C13H13BrN2O2S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | ethyl 2-[(5-bromothiophen-2-yl)methylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NCc1ccc(Br)s1 |
| InChI | InChI=1S/C13H13BrN2O2S/c1-2-18-13(17)10-4-3-7-15-12(10)16-8-9-5-6-11(14)19-9/h3-7H,2,8H2,1H3,(H,15,16) |
| InChIKey | YGQFRXLGCBUYQF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |