C14H16BrN3O4S2 — CID 67085867
ethyl 2-[(5-bromothiophen-2-yl)methylamino]-5-(methylsulfamoyl)pyridine-3-carboxylate (PubChem CID 67085867) has the molecular formula C14H16BrN3O4S2 and a molecular weight of 434.34 g/mol. Its IUPAC name is ethyl 2-[(5-bromothiophen-2-yl)methylamino]-5-(methylsulfamoyl)pyridine-3-carboxylate.
| Compound Name | ethyl 2-[(5-bromothiophen-2-yl)methylamino]-5-(methylsulfamoyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 67085867 |
| Molecular Formula | C14H16BrN3O4S2 |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 432.98 |
| IUPAC Name | ethyl 2-[(5-bromothiophen-2-yl)methylamino]-5-(methylsulfamoyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)NC)cnc1NCc1ccc(Br)s1 |
| InChI | InChI=1S/C14H16BrN3O4S2/c1-3-22-14(19)11-6-10(24(20,21)16-2)8-18-13(11)17-7-9-4-5-12(15)23-9/h4-6,8,16H,3,7H2,1-2H3,(H,17,18) |
| InChIKey | ZQQJUPYGSFCOSB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |