C13H16N4O2 — CID 82874044
ethyl 2-[(1-methylpyrazol-3-yl)methylamino]pyridine-3-carboxylate (PubChem CID 82874044) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is ethyl 2-[(1-methylpyrazol-3-yl)methylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[(1-methylpyrazol-3-yl)methylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 82874044 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | ethyl 2-[(1-methylpyrazol-3-yl)methylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NCc1ccn(C)n1 |
| InChI | InChI=1S/C13H16N4O2/c1-3-19-13(18)11-5-4-7-14-12(11)15-9-10-6-8-17(2)16-10/h4-8H,3,9H2,1-2H3,(H,14,15) |
| InChIKey | ZIGAHQXEYVCSDS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |