C12H13N3O2 — CID 79106249
ethyl 2-(pyrrol-1-ylamino)pyridine-3-carboxylate (PubChem CID 79106249) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is ethyl 2-(pyrrol-1-ylamino)pyridine-3-carboxylate.
| Compound Name | ethyl 2-(pyrrol-1-ylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 79106249 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | ethyl 2-(pyrrol-1-ylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1Nn1cccc1 |
| InChI | InChI=1S/C12H13N3O2/c1-2-17-12(16)10-6-5-7-13-11(10)14-15-8-3-4-9-15/h3-9H,2H2,1H3,(H,13,14) |
| InChIKey | JAJWPKZHNRCVRG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |