C12H18N2OS — CID 106430205
3-ethoxy-N-(2-prop-2-enylsulfanylethyl)pyridin-2-amine (PubChem CID 106430205) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 3-ethoxy-N-(2-prop-2-enylsulfanylethyl)pyridin-2-amine.
| Compound Name | 3-ethoxy-N-(2-prop-2-enylsulfanylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106430205 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-ethoxy-N-(2-prop-2-enylsulfanylethyl)pyridin-2-amine |
| SMILES | C=CCSCCNc1ncccc1OCC |
| InChI | InChI=1S/C12H18N2OS/c1-3-9-16-10-8-14-12-11(15-4-2)6-5-7-13-12/h3,5-7H,1,4,8-10H2,2H3,(H,13,14) |
| InChIKey | WZXJUYHFOABNSM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|