C12H20N4OS — CID 114187281
4-N-(2-prop-2-enylsulfanylethyl)-6-propoxypyrimidine-4,5-diamine (PubChem CID 114187281) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is 4-N-(2-prop-2-enylsulfanylethyl)-6-propoxypyrimidine-4,5-diamine.
| Compound Name | 4-N-(2-prop-2-enylsulfanylethyl)-6-propoxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 114187281 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-N-(2-prop-2-enylsulfanylethyl)-6-propoxypyrimidine-4,5-diamine |
| SMILES | C=CCSCCNc1ncnc(OCCC)c1N |
| InChI | InChI=1S/C12H20N4OS/c1-3-6-17-12-10(13)11(15-9-16-12)14-5-8-18-7-4-2/h4,9H,2-3,5-8,13H2,1H3,(H,14,15,16) |
| InChIKey | SAMSUUZHOHFINU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|